1-Methyl-2-phenylindole
- Product Name1-Methyl-2-phenylindole
- CAS3558-24-5
- MFC15H13N
- MW207.27
- EINECS222-618-1
- MOL File3558-24-5.mol
Chemical Properties
| Melting point | 98-100 °C (lit.) |
| Boiling point | 336.3°C (rough estimate) |
| Density | 1.0880 (rough estimate) |
| refractive index | 1.5720 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 148770 |
| InChI | InChI=1S/C15H13N/c1-16-14-10-6-5-9-13(14)11-15(16)12-7-3-2-4-8-12/h2-11H,1H3 |
| InChIKey | SFWZZSXCWQTORH-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C=C1C1=CC=CC=C1 |
| CAS DataBase Reference | 3558-24-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Indole, 1-methyl-2-phenyl- (3558-24-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
