| Melting point |
236-239 °C(lit.) |
| Boiling point |
423°C (rough estimate) |
| Density |
1.2419 (rough estimate) |
| refractive index |
1.6450 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
DMSO:5.0(Max Conc. mg/mL);17.84(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:2):0.3(Max Conc. mg/mL);1.07(Max Conc. mM) |
| form |
Powder |
| pka |
3.35±0.10(Predicted) |
| color |
Off-white to yellow to beige to orange to tan |
| optical activity |
[α]20/D +12.5°, c = 1 in 0.5 M HCl |
| BRN |
2817528 |
| InChI |
InChI=1/C13H16N2O5/c14-9(7-11(16)17)12(18)15-10(13(19)20)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,14H2,(H,15,18)(H,16,17)(H,19,20)/t9-,10-/s3 |
| InChIKey |
YZQCXOFQZKCETR-DPIMBTEZNA-N |
| SMILES |
C1(=CC=CC=C1)C[C@@H](C(=O)O)NC(=O)[C@@H](N)CC(=O)O |&1:7,14,r| |
