N-Benzyl-3-pyrrolidinol
- Product NameN-Benzyl-3-pyrrolidinol
- CAS775-15-5
- MFC11H15NO
- MW177.24
- EINECS212-273-5
- MOL File775-15-5.mol
Chemical Properties
| Boiling point | 113-115 °C2 mm Hg(lit.) |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 14.82±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 6039 |
| InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2 |
| InChIKey | YQMXOIAIYXXXEE-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(O)C1 |
| CAS DataBase Reference | 775-15-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 1 |
| F | 10-34 |
| HazardClass | 6.1 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |