| Melting point |
>300 °C(lit.) |
| Boiling point |
262.49°C (rough estimate) |
| Density |
1.2104 (rough estimate) |
| refractive index |
1.4795 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
pK1:4.18 ;pK2:5.42 (16°C) |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
Soluble in hot methanol (almost transparency), ethanol, acetone. Slightly soluble in ether and water |
| InChI |
InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6- |
| InChIKey |
PXGZQGDTEZPERC-IZLXSQMJSA-N |
| SMILES |
[C@@H]1(C(O)=O)CC[C@@H](C(O)=O)CC1 |
| CAS DataBase Reference |
619-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,4-Cyclohexanedicarboxylic acid, trans-(619-82-9) |
