1,3-Diamino-2,4,5,6-tetrafluorobenzene
- Product Name1,3-Diamino-2,4,5,6-tetrafluorobenzene
- CAS1198-64-7
- MFC6H4F4N2
- MW180.1
- EINECS214-837-6
- MOL File1198-64-7.mol
Chemical Properties
| Melting point | 145 °C |
| Boiling point | 213.1±35.0 °C(Predicted) |
| Density | 1.624±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 1.34±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C6H4F4N2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h11-12H2 |
| InChIKey | FVFYRXJKYAVFSB-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C(F)=C(N)C(F)=C1F |
| CAS DataBase Reference | 1198-64-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, 2,3,5,6-tetrafluoro- (1198-64-7) |