4-Methoxyphenyl chloroformate
- Product Name4-Methoxyphenyl chloroformate
- CAS7693-41-6
- MFC8H7ClO3
- MW186.59
- EINECS200-110-4
- MOL File7693-41-6.mol
Chemical Properties
| Boiling point | 49 °C0.27 mm Hg(lit.) |
| Density | 1.255 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| InChI | InChI=1S/C8H7ClO3/c1-11-6-2-4-7(5-3-6)12-8(9)10/h2-5H,1H3 |
| InChIKey | CCFSGQKTSBIIHG-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC1=CC=C(OC)C=C1)=O |
| EPA Substance Registry System | Carbonochloridic acid, 4-methoxyphenyl ester (7693-41-6) |
Safety Information
| Hazard Codes | T,C |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3277 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
