ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate
- Product Nameethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate
- CAS37178-37-3
- MFC11H15NO4
- MW225.24
- EINECS
- MOL File37178-37-3.mol
Chemical Properties
| Boiling point | 394.2±37.0 °C(Predicted) |
| Density | 1.278±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: ≥12mg/mL at warmed to 60°C |
| pka | 9.67±0.20(Predicted) |
| form | powder |
| color | white to tan |
| optical activity | [α]/D +15 to +19°, c =1 in methanol ([α]/D) |
| Water Solubility | H2O: ≥12mg/mL atwarmed to 60°C |
| InChI | 1S/C11H15NO4/c1-2-16-11(15)8(12)5-7-3-4-9(13)10(14)6-7/h3-4,6,8,13-14H,2,5,12H2,1H3/t8-/m0/s1 |
| InChIKey | NULMGOSOSZBEQL-QMMMGPOBSA-N |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
