N-Glutaryl-L-phenylalanine p-nitroanilide
- Product NameN-Glutaryl-L-phenylalanine p-nitroanilide
- CAS5800-34-0
- MFC20H21N3O6
- MW399.4
- EINECS227-351-4
- MOL File5800-34-0.mol
Chemical Properties
| Melting point | ~200 °C |
| storage temp. | -20°C |
| solubility | methanol with 1 M NH4OH: 50mg/mL, clear to slightly hazy |
| form | Powder |
| color | White |
| BRN | 2919832 |
| InChIKey | LFZGBNATHRHOKZ-KRWDZBQOSA-N |
| SMILES | OC(=O)CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc2ccc(cc2)[N+]([O-])=O |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 9 |
| Storage Class | 11 - Combustible Solids |