| Boiling point |
515.2±38.0 °C(Predicted) |
| Density |
1.606±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C |
| solubility |
H2O: soluble3mg/mL (Dissolve in oxygen-free boiled water containing 0.1% sodium metabisulfite or other antioxidant. Solutions should be freshly prepared and protected from exposure to light.) |
| form |
powder |
| pka |
2.34±0.25(Predicted) |
| color |
off-white |
| Water Solubility |
H2O: 3mg/mL
1 M HCl: 50mg/mL (Solutions should be freshly prepared and protected from exposure to light.) |
| BRN |
2860065 |
| InChI |
1S/C9H11NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,11-13H,1,10H2,(H,14,15) |
| InChIKey |
YLKRUSPZOTYMAT-UHFFFAOYSA-N |
| SMILES |
NC(Cc1cc(O)c(O)cc1O)C(O)=O |
