2',4',6'-Trimethylacetophenone
- Product Name2',4',6'-Trimethylacetophenone
- CAS1667-01-2
- MFC11H14O
- MW162.23
- EINECS216-783-9
- MOL File1667-01-2.mol
Chemical Properties
| Boiling point | 235-236 °C(lit.) |
| Density | 0.975 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Difficult to mix. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.98 |
| Odor Type | Peculiar, strong and persistent odor, simultaneously non-floral and heavy-sweet-floral. Not nearly as pungent as Acetophenone, but still rather chemical in its general character. |
| BRN | 2044595 |
| InChI | InChI=1S/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 |
| InChIKey | XWCIICLTKWRWCI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=C(C)C=C(C)C=C1C)C |
| CAS DataBase Reference | 1667-01-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2',4',6'-Trimethylacetophenone (1667-01-2) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 10 - Combustible liquids |
