1-Ethynyl-3 5-difluorobenzene 97
- Product Name1-Ethynyl-3 5-difluorobenzene 97
- CAS151361-87-4
- MFC8H4F2
- MW138.11
- EINECS
- MOL File151361-87-4.mol
Chemical Properties
| Boiling point | 123-124 °C (lit.) |
| Density | 1.163 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 78 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
| InChIKey | OTDGZDMGSFBZLI-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC(F)=CC(F)=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 2903998090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |