(+)-Dihydrocarveol mixture of isomers
- Product Name(+)-Dihydrocarveol mixture of isomers
- CAS22567-21-1
- MFC10H18O
- MW154.25
- EINECS245-085-7
- MOL File22567-21-1.mol
Chemical Properties
| Boiling point | 225°C (estimate) |
| Density | 0.926 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 90℃ |
| storage temp. | 2-8°C |
| pka | 15.20±0.60(Predicted) |
| optical activity | [α]20/D +20±1°, neat |
| BRN | 5729399 |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-/m0/s1 |
| InChIKey | KRCZYMFUWVJCLI-GUBZILKMSA-N |
| SMILES | C[C@H]1CC[C@@H](C[C@@H]1O)C(C)=C |
| LogP | 2.954 (est) |
Safety Information
| Safety Statements | 23-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
