1-Amino-3-methylbutane hydrochloride
- Product Name1-Amino-3-methylbutane hydrochloride
- CAS541-23-1
- MFC5H14ClN
- MW123.62436
- EINECS
- MOL File541-23-1.mol
Chemical Properties
| Melting point | 65-69 °C |
| Flash point | 65 °C |
| solubility | Soluble in water, ethanol, acetone, ether, and chloroform. |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 10.5 |
| color | White to Almost white |
| BRN | 3947083 |
| InChI | InChI=1S/C5H13N.ClH/c1-5(2)3-4-6;/h5H,3-4,6H2,1-2H3;1H |
| InChIKey | HOMVDRDAAUYWKL-UHFFFAOYSA-N |
| SMILES | C(CN)C(C)C.Cl |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | NT0200000 |
| F | 3-10 |
| HS Code | 2921.19.6190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
