| Melting point |
200°C (dec.) |
| Boiling point |
320.72°C (rough estimate) |
| Density |
1.1417 (rough estimate) |
| refractive index |
1.4640 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Aqueous Base (Slightly), Chloroform (Slightly, Sonicated), Methanol (Slightly） |
| form |
Solid |
| color |
Pale Beige to Beige |
| Water Solubility |
Soluble in water (partly miscible), methanol (50 mg/ml), acetone, dichloromethane and chloroform. |
| BRN |
4136411 |
| InChI |
InChI=1S/C9H16NO3/c1-8(2)5-6(7(11)12)9(3,4)10(8)13/h6H,5H2,1-4H3,(H,11,12) |
| InChIKey |
GEPIUTWNBHBHIO-UHFFFAOYSA-N |
| SMILES |
N1([O])C(C)(C)CC(C(=O)O)C1(C)C |^1:1| |
| CAS DataBase Reference |
2154-68-9(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Pyrrolidinyloxy, 3-carboxy-2,2,5,5-tetramethyl- (2154-68-9) |
