2',7'-Difluorofluorescein
- Product Name2',7'-Difluorofluorescein
- CAS195136-58-4
- MFC20H10F2O5
- MW368.29
- EINECS
- MOL FileMol File
Chemical Properties
| Boiling point | 591.7±50.0 °C(Predicted) |
| Density | 1.70±0.1 g/cm3(Predicted) |
| solubility | Insoluble in water; soluble in N,Ndimethylformamide |
| form | A solid |
| pka | 4.8, (at 22℃);4.7, (at 22℃) |
| color | Orange powder |
| Appearance | Solid Powder |
| ex/em | λex 498, 332 nm; λem 526 nm; pH 8 |
| λmax | 490 nm (Buffer pH 9.0) |
| Major Application | As geothermal tracers;TiO2 nanoparticles for light energy conversion |
| Biological Applications | Detecting atherosclerosis;detecting/monitoring amyloid Aβ production/accumulation/aggregation/disaggregation; diagnosing Alzheimer’s disease;estimating/measuring concentration of cortisol, melatonin, secretory IgA in body fluids;11 evaluating cetuximab-based imaging probe to target epidermal growth factor receptor (EGFR);examining biodistribution of proteins;investigating/measuring protein-protein and protein-nucleic acid interactions;measuring pH of apoplast at the root surface;visualizing hair follicles;as a substrate for measuring β-lactamase activity,phosphatases activity |
| InChI | InChI=1S/C20H10F2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,23-24H |
| InChIKey | FJXJIUHGLVUXQP-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(O)C(F)=C3)OC3=C1C=C(F)C(O)=C3)C1=C(C=CC=C1)C(=O)O2 |