5-(4-Hydroxyphenyl)-5-phenylhydantoin
- Product Name5-(4-Hydroxyphenyl)-5-phenylhydantoin
- CAS2784-27-2
- MFC15H12N2O3
- MW268.27
- EINECS220-492-2
- MOL File2784-27-2.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Boiling point | 411.43°C (rough estimate) |
| Density | 1.1992 (rough estimate) |
| refractive index | 1.5906 (estimate) |
| solubility | soluble50mg/mL, clear, colorless to faintly yellow (DMF:MeOH(2:1)) |
| form | Solid |
| pka | 8.37±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | 36mg/L(37 ºC) |
| InChI | 1S/C15H12N2O3/c18-12-8-6-11(7-9-12)15(10-4-2-1-3-5-10)13(19)16-14(20)17-15/h1-9,18H,(H2,16,17,19,20) |
| InChIKey | XEEDURHPFVXALT-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C2(NC(=O)NC2=O)c3ccccc3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | MU2485000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |