(+/-)-COTININE-D3
- Product Name(+/-)-COTININE-D3
- CAS110952-70-0
- MFC10H9D3N2O
- MW179.23
- EINECS
- MOL File110952-70-0.mol
Chemical Properties
| Melting point | 40-42 °C(lit.) |
| Boiling point | 250 °C150 mm Hg(lit.) |
| Flash point | 9℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | (Colorless to yellow) &_& (viscous liquid or solid) |
| color | Off-White to Brown |
| Stability | Moisture, Temperature Sensitive - Seal Tightly, Store in Freezer, Hygroscopic |
| Major Application | forensics and toxicology |
| InChI | 1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/i1D3 |
| InChIKey | UIKROCXWUNQSPJ-FIBGUPNXSA-N |
| SMILES | N1(C(CCC1=O)c2cnccc2)C([2H])([2H])[2H] |
| EPA Substance Registry System | 2-Pyrrolidinone, 1-(methyl-d3)-5-(3-pyridinyl)- (110952-70-0) |
| CAS Number Unlabeled | 486-56-6 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |