2-Bromo-3-fluorobenzotrifluoride
- Product Name2-Bromo-3-fluorobenzotrifluoride
- CAS104540-42-3
- MFC7H3BrF4
- MW243
- EINECS
- MOL File104540-42-3.mol
Chemical Properties
| Melting point | 167-168° |
| Boiling point | 167-168 °C (lit.) |
| Density | 1.741 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 190 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H3BrF4/c8-6-4(7(10,11)12)2-1-3-5(6)9/h1-3H |
| InChIKey | UERAGXKMOXUWPC-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1Br |
| CAS DataBase Reference | 104540-42-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |