2,4,5-Trifluoro-3-methoxybenzoic acid
- Product Name2,4,5-Trifluoro-3-methoxybenzoic acid
- CAS112811-65-1
- MFC8H5F3O3
- MW206.12
- EINECS000-000-0
- MOL File112811-65-1.mol
Chemical Properties
| Melting point | 105-112 °C(lit.) |
| Boiling point | 284.3±35.0 °C(Predicted) |
| Density | 1.472 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 126 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.75±0.10(Predicted) |
| color | White to Almost white |
| BRN | 7428474 |
| InChI | InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13) |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=C(F)C(OC)=C1F |
| CAS DataBase Reference | 112811-65-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189900 |
