![(S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine Structure](/CAS/GIF/864466-71-7.gif)
(S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine
- Product Name(S)-[(diphenyl)-t-butyldimethylsiloxymethyl]pyrrolidine
- CAS864466-71-7
- MFC23H33NOSi
- MW367.6
- EINECS
- MOL File864466-71-7.mol
Chemical Properties
| Melting point | 71-73°C |
| Boiling point | 445.2±35.0 °C(Predicted) |
| Density | 0.998±0.06 g/cm3(Predicted) |
| Flash point | >110°C (>230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder |
| pka | 10.12±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 10368174 |
| InChI | 1S/C23H33NOSi/c1-22(2,3)26(4,5)25-23(21-17-12-18-24-21,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,21,24H,12,17-18H2,1-5H3/t21-/m0/s1 |
| InChIKey | YJFSFDYMOMREQP-NRFANRHFSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC([C@@H]1CCCN1)(c2ccccc2)c3ccccc3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
