4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester
- Product Name4-tert-Butylcalix[4]arene-tetraacetic acid tetraethyl ester
- CAS97600-39-0
- MFC60H80O12
- MW993.27
- EINECS
- MOL File97600-39-0.mol
Chemical Properties
| Melting point | 155-158 °C |
| Boiling point | 788.39°C (rough estimate) |
| Density | 0.9747 (rough estimate) |
| refractive index | 1.7500 (estimate) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3587002 |
| InChIKey | HZHADWCIBZZJNV-UHFFFAOYSA-N |
| SMILES | C12=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)CC1=C(OCC(OCC)=O)C(=CC(C(C)(C)C)=C1)C2 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |