3-Chloro-4-hydroxybenzoic acid
- Product Name3-Chloro-4-hydroxybenzoic acid
- CAS3964-58-7
- MFC7H5ClO3
- MW172.57
- EINECS223-574-6
- MOL File3964-58-7.mol
Chemical Properties
| Melting point | 171-173 °C(lit.) |
| Boiling point | 331℃ |
| Density | 1.536 |
| refractive index | 1.4580 (estimate) |
| Flash point | 154℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.20±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2207866 |
| InChI | 1S/2C7H5ClO3.H2O/c2*8-5-3-4(7(10)11)1-2-6(5)9;/h2*1-3,9H,(H,10,11);1H2 |
| InChIKey | VXRQGICSNYPXAC-UHFFFAOYSA-N |
| SMILES | O.OC(=O)c1ccc(O)c(Cl)c1.OC(=O)c2ccc(O)c(Cl)c2 |
| CAS DataBase Reference | 3964-58-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |