1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)-
- Product Name1,1'-Bicyclohexyl, 4-ethenyl-4'-propyl-, (trans,trans)-
- CAS116020-44-1
- MFC17H30
- MW234.42
- EINECS601-409-2
- MOL File116020-44-1.mol
Chemical Properties
| Melting point | 36.0 to 40.0 °C |
| Boiling point | 307℃ |
| Density | 0.896 |
| vapor pressure | 0.015-1.3Pa at 20-50℃ |
| Flash point | 130℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | White to Almost white |
| InChI | InChI=1S/C17H30/c1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16/h4,14-17H,2-3,5-13H2,1H3/t14-,15-,16-,17- |
| InChIKey | KHDBEDDPFRHGCN-GARHLSDISA-N |
| SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](C=C)CC1 |
| LogP | 5.7 at 25℃ |