jolkinolide B
- Product Namejolkinolide B
- CAS37905-08-1
- MFC20H26O4
- MW330.42
- EINECS
- MOL File37905-08-1.mol
Chemical Properties
| Melting point | 213-215℃ |
| Boiling point | 497.1±45.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -10 to -25°C |
| solubility | DMSO: 2mg/mL, clear (Warmed) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C20H26O4/c1-10-12-14-19(22-14)9-6-11-17(2,3)7-5-8-18(11,4)13(19)15-20(12,23-15)24-16(10)21/h11,13-15H,5-9H2,1-4H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1 |
| InChIKey | SOVOCMGDFRGRKF-MCDHERAVSA-N |
| SMILES | O1[C@@]32OC(=O)C(=C3[C@H]4O[C@]54[C@@H]([C@H]21)[C@]6([C@@H](C(CCC6)(C)C)CC5)C)C |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
