Morphine-d3 6-b-D-Glucuronide
- Product NameMorphine-d3 6-b-D-Glucuronide
- CAS219533-69-4
- MFC23H27NO9
- MW461.47
- EINECS
- MOL File219533-69-4.mol
Chemical Properties
| Melting point | >230°C (dec.) |
| Flash point | 24℃ |
| storage temp. | Controlled Substance, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | forensics and toxicology |
| InChIKey | GNJCUHZOSOYIEC-YTLCJKNCSA-N |
| SMILES | [2H]C([2H])([2H])N1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O[C@@H]6O[C@@H]([C@@H](O)[C@H](O)[C@H]6O)C(O)=O)c35 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 10-23/24/25-39/23/24/25 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 3 STOT SE 1 |