Methoxydiethylborane
- Product NameMethoxydiethylborane
- CAS7397-46-8
- MFC5H13BO
- MW99.97
- EINECS000-000-0
- MOL File7397-46-8.mol
Chemical Properties
| Boiling point | 89-90 °C |
| Density | 0.761 g/mL at 25 °C (lit.) |
| RTECS | ED6151000 |
| refractive index | n |
| Flash point | 20 °F |
| form | Solution |
| color | Clear colorless to slightly amber |
| Sensitive | Moisture Sensitive |
| BRN | 2231225 |
| InChI | InChI=1S/C5H13BO/c1-4-6(5-2)7-3/h4-5H2,1-3H3 |
| InChIKey | FESAXEDIWWXCNG-UHFFFAOYSA-N |
| SMILES | B(OC)(CC)CC |
| CAS DataBase Reference | 7397-46-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethylmethoxyborane(7397-46-8) |
| EPA Substance Registry System | Borinic acid, diethyl-, methyl ester (7397-46-8) |
Safety Information
| Hazard Codes | F,Xn,Xi,C |
| Risk Statements | 11-36/37/38-22-19-48/22-43-40-37-34-17-53-20/21/22 |
| Safety Statements | 16-26-27-36/37/39-45-61-43-6 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Flam. Liq. 2 Pyr. Liq. 1 Skin Corr. 1B Skin Sens. 1 STOT RE 2 STOT SE 3 |
