4-Methylaminophenol sulfate
- Product Name4-Methylaminophenol sulfate
- CAS55-55-0
- MFC7H11NO5S
- MW221.23
- EINECS200-237-1
- MOL File55-55-0.mol
Chemical Properties
| Melting point | 260 °C (dec.)(lit.) |
| Density | 1.577 |
| refractive index | 1.6510 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: 50 mg/mL, clear |
| form | Powder |
| color | white to faintly beige |
| PH | 3.5-4.5 (20°C, 50g/L in H2O) |
| Water Solubility | 50 g/L (20 ºC) |
| Sensitive | Air Sensitive |
| Merck | 14,6017 |
| BRN | 3919382 |
| Stability | Stability Combustible. Incompatible with strong oxidizing agents, acids, acid halides. |
| InChI | 1S/2C7H9NO.H2O4S/c2*1-8-6-2-4-7(9)5-3-6;1-5(2,3)4/h2*2-5,8-9H,1H3;(H2,1,2,3,4) |
| InChIKey | ZVNPWFOVUDMGRP-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.CNc1ccc(O)cc1.CNc2ccc(O)cc2 |
| CAS DataBase Reference | 55-55-0(CAS DataBase Reference) |
| EPA Substance Registry System | p-Methylaminophenol sulfate (55-55-0) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-48/22-50/53 |
| Safety Statements | 36/37-46-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | SL8650000 |
| F | 8 |
| Autoignition Temperature | 989 °F |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 |
