3-Ethoxysalicylaldehyde
- Product Name3-Ethoxysalicylaldehyde
- CAS492-88-6
- MFC9H10O3
- MW166.17
- EINECS207-765-1
- MOL File492-88-6.mol
Chemical Properties
| Melting point | 66-68 °C (lit.) |
| Boiling point | 263-264 °C (lit.) |
| Density | 1.1097 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| Flash point | 263-264°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 8.30±0.10(Predicted) |
| color | Light yellow to Brown to Dark green |
| Water Solubility | Soluble in cold water. Insoluble in methanol, ethanol, acetone and acetonitrile |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C9H10O3/c1-2-12-8-5-3-4-7(6-10)9(8)11/h3-6,11H,2H2,1H3 |
| InChIKey | OFQBYHLLIJGMNP-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(OCC)=C1O |
| CAS DataBase Reference | 492-88-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 3-ethoxy-2-hydroxy- (492-88-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CU6123000 |
| TSCA | TSCA listed |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ipr-mus: 360 mg/kg COREAF 238,2576,54 |