Fmoc-L-pentafluorophenylalanine
- Product NameFmoc-L-pentafluorophenylalanine
- CAS205526-32-5
- MFC24H16F5NO4
- MW477.38
- EINECS
- MOL File205526-32-5.mol
Chemical Properties
| Melting point | 146-166° |
| Boiling point | 602.9±55.0 °C(Predicted) |
| Density | 1.471±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 3.59±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]/D -20.5±1.0°, c = 1 in methanol |
| Major Application | peptide synthesis |
| InChIKey | DLOGILOIJKBYKA-KRWDZBQOSA-N |
| SMILES | OC(=O)[C@H](Cc1c(F)c(F)c(F)c(F)c1F)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 205526-32-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |