Rhodamine 19 perchlorate
- Product NameRhodamine 19 perchlorate
- CAS62669-66-3
- MFC26H27ClN2O7
- MW514.96
- EINECS263-686-2
- MOL File62669-66-3.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Density | 1.2011 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | room temp |
| form | powder to crystal |
| color | Orange to Brown |
| λmax | >517 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | WRJTXSZPMAXPRF-GVWDPOEBSA-N |
| SMILES | OCl(=O)(=O)=O.CCNc1cc2OC3=CC(=N/CC)\C(C)=CC3=C(c2cc1C)c4ccccc4C(O)=O |
| EPA Substance Registry System | Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(ethylamino)-2,7-dimethyl-, perchlorate (62669-66-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | UN 1479 5.1/PG III |
| WGK Germany | 3 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 3204.90.0000 |
| HazardClass | 5.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |