2-Amino-4'-bromobenzophenone
- Product Name2-Amino-4'-bromobenzophenone
- CAS1140-17-6
- MFC13H10BrNO
- MW276.13
- EINECS
- MOL File1140-17-6.mol
Chemical Properties
| Melting point | 103-110 °C |
| Boiling point | 432.5±25.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -0.36±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | 1S/C13H10BrNO/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H,15H2 |
| InChIKey | WIISOMGJWLLMDG-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c2ccc(Br)cc2 |
| CAS DataBase Reference | 1140-17-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 43-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
