Acetylacetonato(1,5-cyclooctadiene)rhodium(I)
- Product NameAcetylacetonato(1,5-cyclooctadiene)rhodium(I)
- CAS12245-39-5
- MFC13H19O2Rh
- MW310.19
- EINECS
- MOL File12245-39-5.mol
Chemical Properties
| Melting point | 138-140 °C(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| form | Crystals |
| color | Yellow to orange |
| Sensitive | Air Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/C8H12.C5H8O2.Rh/c1-2-4-6-8-7-5-3-1;1-4(6)3-5(2)7;/h1-2,7-8H,3-6H2;3,6H,1-2H3;/q;;+1/p-1/b2-1-,8-7-;4-3-; |
| InChIKey | WDIAJTWVVLHUJU-SUESZSCISA-N |
| SMILES | CC(=O)\C=C(\C)O[Rh].C1CC=CCCC=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | VI9292000 |
| TSCA | No |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |