(S)-(-)-2-Bromopropionic acid
- Product Name(S)-(-)-2-Bromopropionic acid
- CAS32644-15-8
- MFC3H5BrO2
- MW152.97
- EINECS
- MOL File32644-15-8.mol
Chemical Properties
| Melting point | -35 °C |
| Boiling point | 94 °C/11 mmHg |
| Density | 1.70 |
| refractive index | 1.48 |
| Flash point | 101 °C |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform, Dichloromethane, Ethyl Acetate |
| pka | 3.00±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Red to Green |
| optical activity | [α]20/D 25°, neat |
| BRN | 1720261 |
| InChI | InChI=1S/C3H5BrO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | MONMFXREYOKQTI-REOHCLBHSA-N |
| SMILES | C(O)(=O)[C@@H](Br)C |
| CAS DataBase Reference | 32644-15-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2915900090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
