2-Methylallylmagnesium chloride
- Product Name2-Methylallylmagnesium chloride
- CAS5674-01-1
- MFC4H7ClMg
- MW114.86
- EINECS
- MOL File5674-01-1.mol
Chemical Properties
| Boiling point | 65-67 °C |
| Density | 0.915 g/mL at 25 °C |
| Flash point | −6 °F |
| solubility | sol ether, THF |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C4H7.ClH.Mg/c1-4(2)3;;/h1-2H2,3H3;1H;/q;;+1/p-1 |
| InChIKey | BJVFGWYBOLMUEM-UHFFFAOYSA-M |
| SMILES | C([Mg]Cl)C(=C)C |
Safety Information
| Hazard Codes | F,C,Xn |
| Risk Statements | 11-14/15-19-20/21/22-34-40-36/37/38 |
| Safety Statements | 16-26-27-36/37/39-45-43-36/37 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | - |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 2 |