| Boiling point |
187-190 °C(lit.) |
| Density |
0.863 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.493(lit.) |
| Flash point |
138 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Specific Gravity |
0.863 |
| Water Solubility |
Insoluble in water. |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| BRN |
1928113 |
| InChI |
InChI=1S/C10H16Si/c1-11(2,3)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey |
MRIWRLGWLMRJIW-UHFFFAOYSA-N |
| SMILES |
C1(C[Si](C)(C)C)=CC=CC=C1 |
| CAS DataBase Reference |
770-09-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Trimethylbenzylsilane (770-09-2) |
