Brilliant Cresyl Blue
- Product NameBrilliant Cresyl Blue
- CAS81029-05-2
- MFC17H21Cl4N4OZn-
- MW504.56
- EINECS279-675-0
- MOL File81029-05-2.mol
Chemical Properties
| Melting point | 233-236 °C(lit.) |
| Boiling point | 78 °C |
| Density | 0.808 |
| Flash point | 15 °C |
| storage temp. | Store at +15°C to +30°C. |
| solubility | DMSO (Slghtly), Ethanol (Slightly), Water (Slightly) |
| Colour Index | 51010 |
| form | Crystalline Powder |
| pka | 6.0, 11.0(at 25℃) |
| color | White to off-white |
| Odor | Odorless |
| PH Range | 3.7 at 20°C |
| BRN | 5690713 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C17H21N4O.4ClH.Zn/c1-4-21(5-2)11-6-7-14-15(8-11)22-17-10(3)12(18)9-13(19)16(17)20-14;;;;;/h6-9H,4-5,18-19H2,1-3H3;4*1H;/q+1;;;;;+2/p-4 |
| InChIKey | MJQMEHNJPRMZLG-UHFFFAOYSA-J |
| SMILES | [Zn+2]([Cl-])([Cl-])([Cl-])[Cl-].NC1=CC(N)=C(C)C2=[O+]C3=CC(N(CC)CC)=CC=C3N=C12 |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 3-10-21 |
| PackingGroup | II |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |
