Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt
- Product NameGuanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt
- CAS7361-07-1
- MFC17H31N3O.C14H21N6O8P
- MW725.77
- EINECS
- MOL File7361-07-1.mol
Chemical Properties
| storage temp. | -20°C |
| solubility | water: 50 mg/mL, clear, colorless to light yellow |
| form | powder |
| biological source | synthetic (organic) |
| Water Solubility | water: 50mg/mL, clear, colorless to light yellow |
| InChIKey | CFNWUGDJWKRMBL-VAMAKUSHSA-N |
| SMILES | C1CCC(CC1)N\C(=N\C2CCCCC2)N3CCOCC3.NC4=NC(=O)c5ncn([C@@H]6O[C@H](COP(O)(=O)N7CCOCC7)[C@@H](O)[C@H]6O)c5N4 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38-25 |
| Safety Statements | 22-26-36-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |