Guanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt
- Product NameGuanosine 5'-monophosphomorpholidate 4-morpholine-N,N'-dicyclohexylcarboxamidine salt
- CAS7361-07-1
- CBNumberCB4377090
- MFC17H31N3O.C14H21N6O8P
- MW725.77
- MDL NumberMFCD00079328
- MOL File7361-07-1.mol
- MSDS FileSDS
Chemical Properties
| storage temp. | -20°C |
| solubility | water: 50 mg/mL, clear, colorless to light yellow |
| form | powder |
| biological source | synthetic (organic) |
| Water Solubility | water: 50mg/mL, clear, colorless to light yellow |
| InChIKey | CFNWUGDJWKRMBL-VAMAKUSHSA-N |
| SMILES | C1CCC(CC1)N\C(=N\C2CCCCC2)N3CCOCC3.NC4=NC(=O)c5ncn([C@@H]6O[C@H](COP(O)(=O)N7CCOCC7)[C@@H](O)[C@H]6O)c5N4 |
| UNSPSC Code | 41106305 |
| NACRES | NA.51 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38-25 |
| Safety Statements | 22-26-36-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |