Fmoc-tranexamic acid
- Product NameFmoc-tranexamic acid
- CAS167690-53-1
- MFC23H25NO4
- MW379.45
- EINECS
- MOL File167690-53-1.mol
Chemical Properties
| Melting point | 188 °C |
| Boiling point | 604.9±28.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 4.85±0.10(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | 1S/C23H25NO4/c25-22(26)16-11-9-15(10-12-16)13-24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,15-16,21H,9-14H2,(H,24,27)(H,25,26)/t15-,16- |
| InChIKey | MLMIBGARTUSGND-WKILWMFISA-N |
| SMILES | OC(=O)[C@@H]1CC[C@H](CC1)CNC(=O)OCC2c3ccccc3-c4ccccc24 |
Safety Information
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |