4-((3,5-Dichloro-2-hydroxybenzyl)amino)-2-hydroxybenzoic acid
- Product Name4-((3,5-Dichloro-2-hydroxybenzyl)amino)-2-hydroxybenzoic acid
- CAS1181226-02-7
- MFC14H11Cl2NO4
- MW328.15
- EINECS
- MOL File1181226-02-7.mol
Chemical Properties
| Boiling point | 530.4±50.0 °C(Predicted) |
| Density | 1.617±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥5mg/mL (warmed to 60° C) |
| pka | 3.40±0.10(Predicted) |
| form | powder |
| color | white to tan |
| InChI | 1S/C14H11Cl2NO4/c15-8-3-7(13(19)11(16)4-8)6-17-9-1-2-10(14(20)21)12(18)5-9/h1-5,17-19H,6H2,(H,20,21) |
| InChIKey | RTEYSQSXRFVKTJ-UHFFFAOYSA-N |
| SMILES | OC1=C(Cl)C=C(Cl)C=C1CNC(C=C2)=CC(O)=C2C(O)=O |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
