![7-Bromo-1H-pyrazolo[4,3-c]pyridine Structure](/CAS/20150408/GIF/1256821-58-5.gif)
7-Bromo-1H-pyrazolo[4,3-c]pyridine
- Product Name7-Bromo-1H-pyrazolo[4,3-c]pyridine
- CAS1256821-58-5
- MFC6H4BrN3
- MW198.02
- EINECS
- MOL File1256821-58-5.mol
Chemical Properties
| Boiling point | 357.5±22.0 °C(Predicted) |
| Density | 1.894±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 9.46±0.40(Predicted) |
| Appearance | yellow solid |
| InChI | InChI=1S/C6H4BrN3/c7-5-3-8-1-4-2-9-10-6(4)5/h1-3H,(H,9,10) |
| InChIKey | AIFRKKWUAVZXQP-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Br)C2NN=CC1=2 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
![Synthesis of 7-BROMO-1H-PYRAZOLO[4,3-C]PYRIDINE](/NewsImg/2026-08-24/6392317414461233225356131.png "Synthesis of 7-BROMO-1H-PYRAZOLO[4,3-C]PYRIDINE")