(4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-dicarboxylic acid dimethyl ester
- Product Name(4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-dicarboxylic acid dimethyl ester
- CAS37031-29-1
- MFC9H14O6
- MW218.2
- EINECS
- MOL File37031-29-1.mol
Chemical Properties
| Melting point | 40-43℃ |
| Boiling point | 139 °C/16 mmHg |
| Density | 1.19 |
| refractive index | 1.44 |
| Flash point | 110 °C - closed cup |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | White to Yellow to Green |
| optical activity | [α]20/D 54°, neat |
| BRN | 15406 |
| InChI | InChI=1S/C9H14O6/c1-9(2)14-5(7(10)12-3)6(15-9)8(11)13-4/h5-6H,1-4H3/t5-,6-/m1/s1 |
| InChIKey | ROZOUYVVWUTPNG-PHDIDXHHSA-N |
| SMILES | O1[C@@H](C(OC)=O)[C@H](C(OC)=O)OC1(C)C |
| CAS DataBase Reference | 37031-29-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 2932999099 |
| Storage Class | 10 - Combustible liquids |
