4-Methylumbelliferyl-beta-D-cellobiopyranoside
- Product Name4-Methylumbelliferyl-beta-D-cellobiopyranoside
- CAS72626-61-0
- MFC22H28O13
- MW500.45
- EINECS276-744-7
- MOL File72626-61-0.mol
Chemical Properties
| Melting point | 248 °C(dec.) |
| Boiling point | 830.3±65.0 °C(Predicted) |
| Density | 1.65 |
| storage temp. | 2-8°C |
| solubility | water: 19.60-20.40 mg/mL, clear, colorless to faintly yellow |
| form | powder to crystal |
| pka | 12.61±0.70(Predicted) |
| color | White to Almost white |
| Water Solubility | water: 19.60-20.40mg/mL, clear, colorless to faintly yellow |
| InChIKey | PRTGXBPFDYMIJH-NOEKHSTCNA-N |
| SMILES | CC1=CC(=O)OC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O[C@@]4([H])[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O4)O)[C@@H](CO)O3)O)=CC=C12 |&1:10,11,12,14,16,18,19,21,23,28,r| |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |