Chloroplatinic acid hexahydrate
- Product NameChloroplatinic acid hexahydrate
- CAS18497-13-7
- MFCl6H3OPt-
- MW426.81
- EINECS629-612-1
- MOL File18497-13-7.mol
Chemical Properties
| Melting point | 60 °C |
| Density | 2.430 |
| storage temp. | room temp |
| solubility | H2O: soluble0.5M, clear, orange |
| form | Solid Powder |
| color | orange |
| Water Solubility | Soluble in water, ethanol, ether, ethyl acetate and acetone. Insoluble in nitric acid. |
| Sensitive | Hygroscopic |
| Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 |
| Stability | Hygroscopic |
| InChI | InChI=1S/6ClH.H2O.Pt/h6*1H;1H2;/q;;;;;;;+4/p-5 |
| InChIKey | KVERJCFPWMYIII-UHFFFAOYSA-J |
| SMILES | [Pt+4]([Cl-])([Cl-])([Cl-])([Cl-])([Cl-])[Cl-].[H+].O |
| CAS DataBase Reference | 18497-13-7(CAS DataBase Reference) |
| EPA Substance Registry System | Platinate(2-), hexachloro-, dihydrogen, hexahydrate, (OC-6-11)- (18497-13-7) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 42/43-34-25 |
| Safety Statements | 45-36/37/39-26-22 |
| RIDADR | UN 2507 8/PG 3 |
| WGK Germany | 1 |
| RTECS | TP1510000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28439000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |
| Toxicity | mouse,LD50,intraperitoneal,82mg/kg (82mg/kg),Toxicology and Applied Pharmacology. Vol. 49, Pg. 41, 1979. |
