Maropitant citrate hydrate
- Product NameMaropitant citrate hydrate
- CAS359875-09-5
- MFC38H48N2O8
- MW660.81
- EINECS201-069-1
- MOL File359875-09-5.mol
Chemical Properties
| Melting point | 153-159 °C(lit.) |
| Flash point | 100 °C |
| storage temp. | 2-8°C |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | white to off-white crystalline powder |
| Water Solubility | Water: 3 mg/mL (4.42 mM) |
| Major Application | agriculture environmental food and beverages || microbiology |
| InChIKey | XDZPFSKCXRGRIO-OHTRWSNQNA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.C(C1C=CC=CC=1)(C1C=CC=CC=1)[C@@H]1N2CCC(CC2)[C@@H]1NCC1C=C(C(C)(C)C)C=CC=1OC |&1:26,33,r| |
| CAS DataBase Reference | 359875-09-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 41-42/43-36/37/38-25 |
| Safety Statements | 26-39-45-36/37-22 |
| RIDADR | UN 3284 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | GE7350000 |
| F | 9 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |