4-Bromo-2-(Trifluoromethyl) Benzoic Acid
- Product Name4-Bromo-2-(Trifluoromethyl) Benzoic Acid
- CAS320-31-0
- MFC8H4BrF3O2
- MW269.02
- EINECS642-807-6
- MOL File320-31-0.mol
Chemical Properties
| Melting point | 121.0 to 125.0 °C |
| Boiling point | 275.2±40.0 °C(Predicted) |
| Density | 1.773±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.00±0.36(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H4BrF3O2/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | JXHWAPDBDXPBEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1C(F)(F)F |
