1,3-Diiodo-5,5-dimethylhydantoin
- Product Name1,3-Diiodo-5,5-dimethylhydantoin
- CAS2232-12-4
- MFC5H6I2N2O2
- MW379.92
- EINECS
- MOL File2232-12-4.mol
Chemical Properties
| Melting point | 198°C(dec.)(lit.) |
| Boiling point | 298.4±23.0 °C(Predicted) |
| Density | 2.69±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | sol acetone; slightly sol CH2Cl2 |
| form | powder to crystal |
| pka | -3.25±0.40(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 146040 |
| InChI | InChI=1S/C5H6I2N2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3 |
| InChIKey | RDZHCKRAHUPIFK-UHFFFAOYSA-N |
| SMILES | C1(=O)N(I)C(C)(C)C(=O)N1I |
Safety Information
| Hazard Codes | O,C,N |
| Risk Statements | 8-35-50/53 |
| Safety Statements | 26-36/37/39-45-60-61 |
| RIDADR | UN 3085 8(5.1) / PGII |
| WGK Germany | 3 |
| RTECS | MU0970000 |
| HazardClass | 5.1/8 |
| PackingGroup | II |
| HS Code | 2933210090 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Ox. Sol. 2 Skin Corr. 1B |
