2-Aminopurine nitrate salt
- Product Name2-Aminopurine nitrate salt
- CAS51-16-1
- MFC5H6N6O3
- MW198.14
- EINECS
- MOL File51-16-1.mol
Chemical Properties
| solubility | water: 50 mg/mL, clear, faintly to light yellow |
| form | powder |
| biological source | synthetic |
| Water Solubility | water: 50mg/mL, clear, faintly to light yellow |
| InChI | 1S/C5H5N5.HNO3/c6-5-7-1-3-4(10-5)9-2-8-3;2-1(3)4/h1-2H,(H3,6,7,8,9,10);(H,2,3,4) |
| InChIKey | PGDNOZBGABWZLD-UHFFFAOYSA-N |
| SMILES | O[N+]([O-])=O.Nc1ncc2[nH]cnc2n1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | UO7505700 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |