| Boiling point |
198 °C0.08 mm Hg(lit.) |
| Density |
0.905±0.06 g/cm3(Predicted) |
| Flash point |
62 °C |
| storage temp. |
-20°C |
| solubility |
0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) |
| pka |
4.78±0.10(Predicted) |
| form |
liquid |
| color |
Colorless to light yellow |
| biological source |
plant |
| Major Application |
food and beverages |
| InChI |
1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6-,10-9- |
| InChIKey |
XSXIVVZCUAHUJO-HZJYTTRNSA-N |
| SMILES |
CCCCC\C=C/C\C=C/CCCCCCCCCC(O)=O |
| CAS DataBase Reference |
2091-39-6(CAS DataBase Reference) |
