5-(4-Methylphenyl)-5-phenylhydantoin
- Product Name5-(4-Methylphenyl)-5-phenylhydantoin
- CAS51169-17-6
- MFC16H14N2O2
- MW266.29
- EINECS257-028-3
- MOL File51169-17-6.mol
Chemical Properties
| Melting point | 225-226 °C (lit.) |
| Boiling point | 409.5°C (rough estimate) |
| Density | 1.1262 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| storage temp. | −20°C |
| solubility | soluble50mg/mL, clear to slightly hazy, colorless to light yellow (DMF:HCl(2:1)) |
| pka | 8.33±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | 1S/C16H14N2O2/c1-11-7-9-13(10-8-11)16(12-5-3-2-4-6-12)14(19)17-15(20)18-16/h2-10H,1H3,(H2,17,18,19,20) |
| InChIKey | WPAPSGQWYNPWCZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)C2(NC(=O)NC2=O)c3ccccc3 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-40-63 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29332100 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Repr. 2 |